189003-13-2 Usage
Chemical Structure
Contains a fluorine atom and a phenylmethylamino group
Type
Pyrimidinone derivative
Potential Uses
Pharmaceutical intermediate, potential applications in drug development
Further Investigation
Specific properties and potential uses would need to be determined through research and experimentation.
Check Digit Verification of cas no
The CAS Registry Mumber 189003-13-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,9,0,0 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 189003-13:
(8*1)+(7*8)+(6*9)+(5*0)+(4*0)+(3*3)+(2*1)+(1*3)=132
132 % 10 = 2
So 189003-13-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10FN3O/c12-9-6-10(16)15-11(14-9)13-7-8-4-2-1-3-5-8/h1-6H,7H2,(H2,13,14,15,16)
