18904-40-0 Usage
Uses
Used in Pharmaceutical Industry:
Acrophylline is used as a bioactive compound for its potential therapeutic effects. The expression is: acrophylline is used as a pharmaceutical agent for its various biological activities, which may include anti-inflammatory, anti-cancer, or other medicinal properties based on further research and development.
Used in Chemical Research:
In the field of chemical research, acrophylline is used as a starting material or a structural component for the synthesis of novel compounds with potential applications in various industries. The expression is: acrophylline is used as a chemical intermediate for the development of new compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 18904-40-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,9,0 and 4 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 18904-40:
(7*1)+(6*8)+(5*9)+(4*0)+(3*4)+(2*4)+(1*0)=120
120 % 10 = 0
So 18904-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H17NO3/c1-11(2)6-8-18-15-10-12(20-3)4-5-13(15)16(19)14-7-9-21-17(14)18/h4-7,9-10H,8H2,1-3H3
