18905-73-2 Usage
General Description
L-Arginine Beta-Naphthylamide Hydrochloride is a complex chemical compound that combines the amino acid L-arginine with beta-naphthylamide and hydrochloride. It possesses significant biological activity and is commonly used in various biochemical applications. Its most notable use is in enzyme studies, particularly those involving peptidase and protease enzymes where it functions as an effective substrate. The hydrochloride part of the compound provides increased stability and solubility in water, enhancing the compound's efficiency in experimental and research settings. It does not naturally occur, thus is synthesized in laboratories for research purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 18905-73-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,9,0 and 5 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 18905-73:
(7*1)+(6*8)+(5*9)+(4*0)+(3*5)+(2*7)+(1*3)=132
132 % 10 = 2
So 18905-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H21N5O.ClH/c17-14(6-3-9-20-16(18)19)15(22)21-13-8-7-11-4-1-2-5-12(11)10-13;/h1-2,4-5,7-8,10,14H,3,6,9,17H2,(H,21,22)(H4,18,19,20);1H/t14-;/m0./s1