18912-37-3 Usage
Description
4-METHOXYBENZYL CARBAZATE is an organic compound that serves as a valuable intermediate in the synthesis of various chemical compounds and pharmaceuticals. It is characterized by its molecular structure, which includes a carbamate functional group attached to a 4-methoxybenzyl moiety.
Uses
Used in Chemical Synthesis:
4-METHOXYBENZYL CARBAZATE is used as a synthetic intermediate for the preparation of various chemical compounds and pharmaceuticals. Its unique structure allows for further functionalization and modification, making it a versatile building block in organic chemistry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-METHOXYBENZYL CARBAZATE is used as a starting material for the synthesis of various drug candidates. Its derived azide is utilized in N-protection, which is an essential step in the development of new pharmaceutical agents. Additionally, it serves as a starting material for the azide used to introduce the pMZ-amino protection, which can be removed under mild hydrolytic conditions, facilitating the synthesis of complex drug molecules.
Used in Research and Development:
4-METHOXYBENZYL CARBAZATE is also employed in research and development for the exploration of new chemical reactions and the development of innovative synthetic methods. Its unique reactivity and structural features make it an attractive candidate for studying novel reaction mechanisms and developing new synthetic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 18912-37-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,9,1 and 2 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 18912-37:
(7*1)+(6*8)+(5*9)+(4*1)+(3*2)+(2*3)+(1*7)=123
123 % 10 = 3
So 18912-37-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O3/c1-13-8-4-2-7(3-5-8)6-14-9(12)11-10/h2-5H,6,10H2,1H3,(H,11,12)