189281-25-2 Usage
General Description
N-benzyl-3,5,6-trifluoropyridin-2-amine is a chemical compound with the molecular formula C14H11F3N2. It is a derivative of pyridine and features a benzyl group and three fluorine atoms attached to the pyridine ring. N-benzyl-3,5,6-trifluoropyridin-2-amine has potential applications in pharmaceutical and medicinal chemistry, particularly for the development of new drugs and therapies. Its unique structure and properties make it a valuable building block for the synthesis of biologically active molecules. Additionally, the presence of the amine functional group suggests that it may exhibit relevant biological activity and be suitable for further research and development. Overall, N-benzyl-3,5,6-trifluoropyridin-2-amine is a compound with promising potential for various scientific and medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 189281-25-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,9,2,8 and 1 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 189281-25:
(8*1)+(7*8)+(6*9)+(5*2)+(4*8)+(3*1)+(2*2)+(1*5)=172
172 % 10 = 2
So 189281-25-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H9F3N2/c13-9-6-10(14)12(17-11(9)15)16-7-8-4-2-1-3-5-8/h1-6H,7H2,(H,16,17)
