189329-96-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2-METHYL-3-THIOPHENECARBOXAMIDE is utilized as an intermediate in the creation of pharmaceuticals, playing a crucial role in the development of new medications and therapeutic agents.
Used in Agrochemical Production:
2-METHYL-3-THIOPHENECARBOXAMIDE also serves as an intermediate in the synthesis of agrochemicals, which are essential for the agricultural industry to protect crops and enhance yields.
Used in Organic Compounds Synthesis:
2-METHYL-3-THIOPHENECARBOXAMIDE is used in the synthesis of various organic compounds, contributing to the advancement of organic chemistry and the development of new chemical entities.
Used as a Reagent in Chemical Reactions:
As a reagent, 2-METHYL-3-THIOPHENECARBOXAMIDE is involved in a range of chemical reactions, facilitating the transformation of other substances and aiding in the synthesis process.
Used in Medicinal Chemistry and Drug Discovery:
Due to its distinctive structural and property profile, 2-METHYL-3-THIOPHENECARBOXAMIDE is employed in the field of medicinal chemistry and drug discovery, where it may contribute to the identification and development of novel pharmaceutical agents.
Check Digit Verification of cas no
The CAS Registry Mumber 189329-96-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,9,3,2 and 9 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 189329-96:
(8*1)+(7*8)+(6*9)+(5*3)+(4*2)+(3*9)+(2*9)+(1*6)=192
192 % 10 = 2
So 189329-96-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NOS/c1-4-5(6(7)8)2-3-9-4/h2-3H,1H3,(H2,7,8)
