189454-29-3 Usage
Uses
Used in Pharmaceutical Industry:
3,4,6-Trimethoxy-1(3H)-isobenzofuranone is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
In the field of organic chemistry, 3,4,6-trimethoxy-1(3H)-isobenzofuranone is used as a building block for the synthesis of more complex molecules. Its reactivity and functional groups make it a valuable component in the creation of novel chemical entities.
Used in Material Science:
3,4,6-Trimethoxy-1(3H)-isobenzofuranone may also find applications in the development of new materials, such as polymers or composites, due to its structural properties and potential for further functionalization.
Used in Flavor and Fragrance Industry:
Given its chemical structure, 3,4,6-trimethoxy-1(3H)-isobenzofuranone could potentially be used in the flavor and fragrance industry as a component in the creation of new scents or flavors.
Check Digit Verification of cas no
The CAS Registry Mumber 189454-29-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,9,4,5 and 4 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 189454-29:
(8*1)+(7*8)+(6*9)+(5*4)+(4*5)+(3*4)+(2*2)+(1*9)=183
183 % 10 = 3
So 189454-29-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H12O5/c1-13-6-4-7-9(8(5-6)14-2)11(15-3)16-10(7)12/h4-5,11H,1-3H3
