1897-43-4 Usage
Uses
Used in Chemical Synthesis:
2,5-DICHLOROTEREPHTHALONITRILE is used as a key intermediate in the synthesis of substituted 7,7,8,8-tetracyanoquinodimethanes (TCNQ). These TCNQ derivatives exhibit unique electronic properties and are valuable in the development of organic materials for electronic devices, such as organic semiconductors and conductors.
Used in Organic Semiconductors:
In the field of organic semiconductors, 2,5-DICHLOROTEREPHTHALONITRILE is utilized as a precursor to create novel materials with tailored electronic properties. These materials can be employed in various electronic applications, such as organic field-effect transistors (OFETs), organic light-emitting diodes (OLEDs), and organic photovoltaics (OPVs), due to their ability to modulate charge transport and improve device performance.
Used in Conductive Polymers:
2,5-DICHLOROTEREPHTHALONITRILE also plays a role in the synthesis of conductive polymers, which are essential components in flexible electronics and sensors. The incorporation of 2,5-DICHLOROTEREPHTHALONITRILE into the polymer backbone can enhance electrical conductivity and improve the overall performance of these materials in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1897-43-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,9 and 7 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1897-43:
(6*1)+(5*8)+(4*9)+(3*7)+(2*4)+(1*3)=114
114 % 10 = 4
So 1897-43-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H2Cl2N2/c9-7-1-5(3-11)8(10)2-6(7)4-12/h1-2H
