1898-72-2 Usage
Uses
Used in Organic Chemistry:
2,4-Dimethoxy-1,3,5-triazine is used as an activating agent for alcohols, enabling their conversion into alkyl chlorides. This application is crucial in the synthesis of a wide range of chemical compounds and substances, making it a valuable component in the field of organic chemistry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,4-Dimethoxy-1,3,5-triazine is used as a key intermediate in the synthesis of various drugs and pharmaceutical compounds. Its ability to activate alcohols for conversion into alkyl chlorides plays a significant role in the development of new and innovative medications.
Used in Chemical Synthesis:
2,4-Dimethoxy-1,3,5-triazine is used as a reagent in the synthesis of other chemicals, contributing to the production of a diverse array of substances. Its reactivity and versatility make it an essential component in the chemical synthesis process, allowing for the creation of new and complex compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 1898-72-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,9 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1898-72:
(6*1)+(5*8)+(4*9)+(3*8)+(2*7)+(1*2)=122
122 % 10 = 2
So 1898-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O2/c1-9-4-6-3-7-5(8-4)10-2/h3H,1-2H3
