1899-39-4 Usage
Uses
Used in Pharmaceutical Research:
5H-Cyclopentapyrimidine-2,4-diamine, 6,7-dihydro(9CI) is used as a research compound for the development of new pharmaceutical agents. Its unique structure and properties make it a promising candidate for the design and synthesis of novel therapeutic agents.
Used in Chemical Research:
In the field of chemical research, 5H-Cyclopentapyrimidine-2,4-diamine, 6,7-dihydro(9CI) serves as a key intermediate or building block for the synthesis of more complex organic molecules. Its versatile structure allows for further functionalization and modification, enabling the exploration of new chemical reactions and the creation of innovative compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1899-39-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,9 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1899-39:
(6*1)+(5*8)+(4*9)+(3*9)+(2*3)+(1*9)=124
124 % 10 = 4
So 1899-39-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N4/c8-6-4-2-1-3-5(4)10-7(9)11-6/h1-3H2,(H4,8,9,10,11)
