19078-57-0 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
1,5-Tetramethylene-1H-pyrazole is used as a precursor in the synthesis of various pharmaceuticals and agrochemicals. Its unique chemical structure allows it to be incorporated into a wide range of compounds, enhancing their therapeutic or pesticidal properties.
Used in Coordination Chemistry:
TMP can act as a ligand, forming complexes with various metal ions. This application is valuable in coordination chemistry, where the interaction between ligands and metal ions can lead to the development of new materials with unique properties.
Used in the Production of Polyurethane Foams and Elastomers:
1,5-Tetramethylene-1H-pyrazole is used as a chain extender in the production of polyurethane foams and elastomers. Its ability to react with other components in the polymerization process contributes to the formation of materials with desirable mechanical and physical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 19078-57-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,0,7 and 8 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 19078-57:
(7*1)+(6*9)+(5*0)+(4*7)+(3*8)+(2*5)+(1*7)=130
130 % 10 = 0
So 19078-57-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2/c1-2-6-9-7(3-1)4-5-8-9/h4-5H,1-3,6H2
