19079-66-4 Usage
Description
DL-ALANYL-DL-NORLEUCINE is a synthetic dipeptide consisting of the amino acids alanine and norleucine, both in their DL (racemic) form. As a non-natural compound, it is not found in nature and has been studied for its potential as a performance enhancer, as well as its role in protein synthesis and muscle growth. Its unique structural properties and potential biological activities also make it a valuable component in the development of novel drugs and bioactive peptides.
Uses
Used in Pharmaceutical Industry:
DL-ALANYL-DL-NORLEUCINE is used as a pharmaceutical intermediate for the synthesis of various drugs and bioactive compounds. Its unique structural properties and potential biological activities contribute to the development of novel therapeutic agents.
Used in Biochemical Research:
DL-ALANYL-DL-NORLEUCINE serves as a research tool in biochemistry, aiding in the study of protein synthesis, muscle growth, and other biological processes. Its non-natural nature allows for the investigation of its effects and interactions in various experimental settings.
Used in Sports Nutrition:
DL-ALANYL-DL-NORLEUCINE is used as a performance enhancer in sports nutrition, potentially supporting protein synthesis and muscle growth. Its supplementation may contribute to improved athletic performance and recovery.
Used in Drug Development:
DL-ALANYL-DL-NORLEUCINE is utilized in the development of novel drugs and bioactive peptides, leveraging its unique structural properties and potential biological activities to create new therapeutic agents for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 19079-66-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,0,7 and 9 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 19079-66:
(7*1)+(6*9)+(5*0)+(4*7)+(3*9)+(2*6)+(1*6)=134
134 % 10 = 4
So 19079-66-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H18N2O3/c1-3-4-5-7(9(13)14)11-8(12)6(2)10/h6-7H,3-5,10H2,1-2H3,(H,11,12)(H,13,14)