19080-53-6 Usage
First component
Derivative of propanoic acid with ethylcarbamoyl and triiodo-phenoxy groups attached
Second component
Derivative of 6-methylaminohexane-1,2,3,4,5-pentol with specific stereochemistry
a. (2R,3 R,4R,5S) notation indicates the spatial arrangement of the substituents around the chiral centers
Pharmaceutical and research applications
These chemicals may have various applications in pharmaceuticals or research, depending on the context and intended purpose.
a. Carbamoyl (-NHCO-) groups
b. Iodo-phenoxy (-OC6H4I3) groups
c. Methyl (-CH3) groups
d. Amino (-NH2) group
Structural features
The compound has a complex structure with multiple branches and functional groups, which may contribute to its specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 19080-53-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,0,8 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 19080-53:
(7*1)+(6*9)+(5*0)+(4*8)+(3*0)+(2*5)+(1*3)=106
106 % 10 = 6
So 19080-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H17I3N2O5.C7H17NO5/c1-4-19-13(21)7-9(16)8(14(22)20-5-2)11(18)12(10(7)17)25-6(3)15(23)24;1-8-2-4(10)6(12)7(13)5(11)3-9/h6H,4-5H2,1-3H3,(H,19,21)(H,20,22)(H,23,24);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1