190961-15-0 Usage
Uses
Used in Pharmaceutical Research:
(S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid hydrobromide is used as a research compound for the development of new pharmaceuticals, particularly in the field of medicinal chemistry. Its unique structure and properties make it a valuable tool for studying the interactions of various biological molecules and potential drug candidates.
Used in Chemical Synthesis:
In the chemical industry, (S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid hydrobromide is used as an intermediate in the synthesis of more complex organic compounds. Its versatility in forming salts and its reactivity in certain reactions make it a useful building block for the creation of novel chemical entities.
Used in Analytical Chemistry:
(S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid hydrobromide is employed as a reference material in analytical chemistry, where its well-defined structure and properties can be used to calibrate instruments and validate analytical methods. This ensures the accuracy and reliability of chemical measurements and analyses.
Check Digit Verification of cas no
The CAS Registry Mumber 190961-15-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,0,9,6 and 1 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 190961-15:
(8*1)+(7*9)+(6*0)+(5*9)+(4*6)+(3*1)+(2*1)+(1*5)=150
150 % 10 = 0
So 190961-15-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2.BrH/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H/t9-;/m0./s1
