190961-50-3 Usage
General Description
1,2,3,4-Tetrahydro-3-isoquinoline carboxylic acid hydrobromide is a chemical compound that contains an isoquinoline ring. It is a hydrobromide salt and is commonly used in the preparation of pharmaceutical drugs. 1,2,3,4-TETRAHYDRO-3-ISOQUINOLINE CARBOXYLIC ACID HYDROBROMIDE is known for its potential as an antagonist of dopamine receptors, making it a potential candidate for the treatment of psychiatric and neurological disorders. It is also being researched for its potential in the treatment of addiction and other substance abuse disorders. Additionally, 1,2,3,4-Tetrahydro-3-isoquinoline carboxylic acid hydrobromide has been studied for its potential anti-inflammatory and analgesic properties, making it a versatile chemical in various fields of biomedical research.
Check Digit Verification of cas no
The CAS Registry Mumber 190961-50-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,0,9,6 and 1 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 190961-50:
(8*1)+(7*9)+(6*0)+(5*9)+(4*6)+(3*1)+(2*5)+(1*0)=153
153 % 10 = 3
So 190961-50-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2.BrH/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H/t9-;/m1./s1
