191017-95-5 Usage
Description
3,5-Dinitroisonicotinic acid, a derivative of isonicotinic acid with the molecular formula C6H3N3O6, is a nitrobenzene compound. It is a solid, yellowish powder that is slightly soluble in water. This chemical is recognized for its potential as a building block in the synthesis of various organic compounds, particularly in the pharmaceutical, agricultural, and chemical industries.
Uses
Used in Pharmaceutical Industry:
3,5-Dinitroisonicotinic acid is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs. Its unique chemical structure allows it to be a key component in the creation of medications that address various health conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 3,5-Dinitroisonicotinic acid is utilized as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its role in these applications is to enhance the effectiveness of these products in protecting crops and managing pests.
Used in Chemical Industry:
3,5-Dinitroisonicotinic acid serves as a valuable precursor in the synthesis of other organic compounds within the chemical industry. Its versatility in chemical reactions makes it an essential component in the development of a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 191017-95-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,1,0,1 and 7 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 191017-95:
(8*1)+(7*9)+(6*1)+(5*0)+(4*1)+(3*7)+(2*9)+(1*5)=125
125 % 10 = 5
So 191017-95-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H3N3O6/c10-6(11)5-3(8(12)13)1-7-2-4(5)9(14)15/h1-2H,(H,10,11)
