191021-14-4 Usage
General Description
(1-methyl-1H-imidazol-2-yl)(2-thienyl)methanol is a chemical compound with the molecular formula C11H12N2OS. It is a derivative of imidazole and thiol, and it has a methyl substituent on the imidazole ring and a thienyl group attached to a methanol group. (1-methyl-1H-imidazol-2-yl)(2-thienyl)methanol has been studied for its potential pharmaceutical applications, particularly as an antifungal and antibacterial agent. Additionally, it has shown promise as a potential anti-inflammatory and anti-cancer agent. Its unique structure and potential biological activities make it an interesting target for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 191021-14-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,1,0,2 and 1 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 191021-14:
(8*1)+(7*9)+(6*1)+(5*0)+(4*2)+(3*1)+(2*1)+(1*4)=94
94 % 10 = 4
So 191021-14-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2OS/c1-11-5-4-10-9(11)8(12)7-3-2-6-13-7/h2-6,8,12H,1H3