191024-16-5 Usage
Uses
Used in Pharmaceutical Industry:
8-Amino-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester is utilized as a key intermediate in the synthesis of various biologically active molecules, serving as a precursor for potential drug candidates. Its unique structure allows for the development of new compounds with possible pharmacological properties, such as anti-inflammatory or antiviral activities.
Used in Organic Chemistry:
In the realm of organic chemistry, 8-Amino-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester is employed as a component in the synthesis of complex organic molecules. Its versatile structure and functional groups make it a valuable asset in creating intricate molecular architectures.
Safety Considerations:
Due to the complex structure and potential reactivity of 8-Amino-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester, it necessitates careful handling and adherence to proper safety protocols when used in laboratory settings. This ensures the safety of researchers and the integrity of experimental outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 191024-16-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,1,0,2 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 191024-16:
(8*1)+(7*9)+(6*1)+(5*0)+(4*2)+(3*4)+(2*1)+(1*6)=105
105 % 10 = 5
So 191024-16-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO4/c1-2-14-11(13)7-3-4-8(12)10-9(7)15-5-6-16-10/h3-4H,2,5-6,12H2,1H3
191024-16-5Relevant academic research and scientific papers
3-(Pyrrolidin-3-yl)-1,3,4-oxadiazol-2(3H)-one derivatives and their use as 5-HT4 ligands
-
, (2008/06/13)
Compounds corresponding to the general formula (I) in which R1represents hydrogen or an alkyl or cycloalkylmethyl group, X1represents hydrogen or a halogen or an alkoxy group, or alternatively OR1and X1together
5-phenyl-3-(piperidin-4-yl)-1,3,4-oxadiazol-2(3H)-one derivatives for use as 5-Ht4 or H3 receptor ligands
-
, (2008/06/13)
Compounds corresponding to the general formula (I) STR1 in which R 1 represents a (C 1 -C 4)alkyl or (C 3 -C 7)cycloalkylmethyl group, X 1 represents a hydrogen or halogen atom or a (C 1 -C 4)alkoxy group or else OR 1 and X 1 together represent a group of
