191024-17-6 Usage
Description
8-Amino-7-chloro-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester is a chemical compound with the molecular formula C11H11ClN2O4. It is an ethyl ester derivative of 8-amino-7-chloro-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid, characterized by the presence of an amino group, a chloro substituent, and a dihydrobenzo[1,4]dioxine ring. 8-Amino-7-chloro-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester is commonly used in pharmaceutical research and development due to its potential medicinal properties and is being studied for its potential use in the treatment of various diseases and conditions.
Uses
Used in Pharmaceutical Research and Development:
8-Amino-7-chloro-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester is used as a research compound for exploring its potential medicinal properties. Its unique chemical structure and functional groups make it a promising candidate for the development of new therapeutic agents.
Used in Drug Design and Synthesis:
In the pharmaceutical industry, 8-Amino-7-chloro-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester is used as a building block or intermediate in the synthesis of various drug molecules. Its versatile chemical structure allows for the introduction of different functional groups and modifications, enabling the design of novel compounds with improved pharmacological properties.
Used in Medicinal Chemistry:
8-Amino-7-chloro-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester is employed as a starting material in medicinal chemistry for the development of new drugs. Its structural features can be exploited to create compounds with specific biological activities, such as targeting particular receptors or enzymes involved in disease pathways.
Used in Drug Screening and Testing:
In the early stages of drug discovery, 8-Amino-7-chloro-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester is used in high-throughput screening assays to identify potential lead compounds with therapeutic potential. Its chemical properties and interactions with biological targets can provide valuable insights into its efficacy and safety profile.
Used in Preclinical and Clinical Studies:
As a promising pharmaceutical candidate, 8-Amino-7-chloro-2,3-dihydrobenzo[1,4]dioxine-5-carboxylic acid ethyl ester is subjected to preclinical and clinical studies to evaluate its safety, efficacy, and pharmacokinetic properties. These studies are crucial for determining its potential as a therapeutic agent and guiding further development.
Check Digit Verification of cas no
The CAS Registry Mumber 191024-17-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,1,0,2 and 4 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 191024-17:
(8*1)+(7*9)+(6*1)+(5*0)+(4*2)+(3*4)+(2*1)+(1*7)=106
106 % 10 = 6
So 191024-17-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H12ClNO4/c1-2-15-11(14)6-5-7(12)8(13)10-9(6)16-3-4-17-10/h5H,2-4,13H2,1H3
