191418-78-7 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-3-methoxypyridine-4-carboxaldehyde is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Agrochemical Industry:
2-Bromo-3-methoxypyridine-4-carboxaldehyde is used as a chemical intermediate in the production of agrochemicals, such as pesticides and herbicides. Its bromine content and reactivity contribute to the effectiveness of these products in controlling pests and weeds.
Used in Dye Industry:
2-Bromo-3-methoxypyridine-4-carboxaldehyde is used as a chemical intermediate in the synthesis of dyes and pigments. Its molecular structure allows for the creation of a wide range of colors and shades, making it a versatile component in the dye industry.
Used in Scientific Research:
2-Bromo-3-methoxypyridine-4-carboxaldehyde is used as a research compound in various scientific studies. Its unique properties and reactivity make it an interesting subject for exploration in fields such as organic chemistry, materials science, and biochemistry.
Properties, usage, instructions, and safety measures should always be thoroughly examined by professionals before handling.
Check Digit Verification of cas no
The CAS Registry Mumber 191418-78-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,1,4,1 and 8 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 191418-78:
(8*1)+(7*9)+(6*1)+(5*4)+(4*1)+(3*8)+(2*7)+(1*8)=147
147 % 10 = 7
So 191418-78-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrNO2/c1-11-6-5(4-10)2-3-9-7(6)8/h2-4H,1H3
