19180-79-1 Usage
Uses
Used in Pharmaceutical Industry:
5,6-Diphenyl-2-morpholinone is used as an intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the formation of complex organic molecules that are integral to drug development.
Used in Organic Chemistry:
DPM is utilized as a reagent in organic chemistry, facilitating various chemical reactions and processes that are essential for the creation of new organic compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5,6-Diphenyl-2-morpholinone is employed as a reagent to assist in the development of new medicinal agents, potentially leading to advancements in treatment options.
Used in Agrochemical Production:
5,6-Diphenyl-2-morpholinone is used as a building block in the production of agrochemicals, playing a crucial role in the synthesis of compounds that contribute to agricultural productivity and pest control.
Used in Specialty Chemicals Industry:
DPM is also used in the production of specialty chemicals, where its unique properties allow for the creation of niche chemical products that serve specific industrial needs.
Check Digit Verification of cas no
The CAS Registry Mumber 19180-79-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,1,8 and 0 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 19180-79:
(7*1)+(6*9)+(5*1)+(4*8)+(3*0)+(2*7)+(1*9)=121
121 % 10 = 1
So 19180-79-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H15NO2/c18-14-11-17-15(12-7-3-1-4-8-12)16(19-14)13-9-5-2-6-10-13/h1-10,15-17H,11H2
