19232-39-4 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl acetoacetate, sodium salt is used as a building block for the production of pharmaceuticals. Its chemical properties allow it to be a key component in the synthesis of various medicinal compounds, contributing to the development of new drugs and therapies.
Used in Agrochemical Industry:
In the agrochemical industry, ethyl acetoacetate, sodium salt is utilized as a building block for the synthesis of agrochemicals. Its reactivity and ability to form different chemical structures make it suitable for creating substances used in agriculture to protect crops and enhance yields.
Used in Organic Synthesis:
Ethyl acetoacetate, sodium salt is used as a versatile reagent in organic synthesis across various industries. Its capacity to engage in multiple types of chemical reactions, such as condensation, esterification, and alkylation, makes it an indispensable tool for creating a wide range of organic compounds.
Used in Flavor and Fragrance Industry:
ETHYL ACETOACETATE, SODIUM SALT is also used as a reagent in the preparation of flavorings and fragrances. Its ability to contribute to the formation of aromatic compounds makes it a valuable ingredient in the development of scents and tastes for various products.
Used in Dye and Pigment Synthesis:
Ethyl acetoacetate, sodium salt is used as a component in the synthesis of dyes and pigments. Its role in creating a diverse palette of colors is essential for applications in textiles, printing, and other industries that rely on colorants for their products.
Check Digit Verification of cas no
The CAS Registry Mumber 19232-39-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,2,3 and 2 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 19232-39:
(7*1)+(6*9)+(5*2)+(4*3)+(3*2)+(2*3)+(1*9)=104
104 % 10 = 4
So 19232-39-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H9O3.Na/c1-3-9-6(8)4-5(2)7;/h4H,3H2,1-2H3;/rC6H9NaO3/c1-3-10-6(9)5(7)4(2)8/h5H,3H2,1-2H3
