192323-44-7 Usage
Uses
Used in Medicinal Chemistry:
2-Chloro-6-fluoroquinazolin-4-amine is used as a reagent or building block for the synthesis of complex chemical structures, particularly in the field of medicinal chemistry. Its unique biological activities make it a valuable compound for the development of new pharmaceuticals and therapeutic agents.
Used in Chemical Synthesis:
In the chemical industry, 2-Chloro-6-fluoroquinazolin-4-amine is used as a key intermediate in the preparation of various complex molecules. Its role as a building block allows for the creation of a wide range of chemical products with potential applications in different sectors.
Used in Research and Development:
2-Chloro-6-fluoroquinazolin-4-amine is employed in research and development settings to explore its potential applications and properties. Its unique characteristics make it an interesting subject for scientific studies, which could lead to new discoveries and advancements in related fields.
Check Digit Verification of cas no
The CAS Registry Mumber 192323-44-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,2,3,2 and 3 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 192323-44:
(8*1)+(7*9)+(6*2)+(5*3)+(4*2)+(3*3)+(2*4)+(1*4)=127
127 % 10 = 7
So 192323-44-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClFN3/c9-8-12-6-2-1-4(10)3-5(6)7(11)13-8/h1-3H,(H2,11,12,13)
