19296-90-3 Usage
Uses
Used in Organic Synthesis:
(+)-1,5,5-trimethyl-2-thiabicyclo[2.2.2]octane is utilized as a key building block in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for the formation of multiple bonds and interactions, facilitating the synthesis of a wide range of compounds.
Used as a Chiral Auxiliary in Asymmetric Synthesis:
In the field of asymmetric synthesis, (+)-1,5,5-trimethyl-2-thiabicyclo[2.2.2]octane operates as an essential chiral auxiliary. Its distinct chirality is instrumental in controlling the stereochemistry of reactions, enabling the production of enantiomerically pure compounds, which is crucial in pharmaceutical development and other applications where stereochemistry impacts biological activity.
Used in Pharmaceutical Synthesis:
(+)-1,5,5-trimethyl-2-thiabicyclo[2.2.2]octane has been investigated for its potential as a precursor in the synthesis of pharmaceuticals and other biologically active compounds. Its incorporation into these molecules can contribute to the development of new drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 19296-90-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,2,9 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 19296-90:
(7*1)+(6*9)+(5*2)+(4*9)+(3*6)+(2*9)+(1*0)=143
143 % 10 = 3
So 19296-90-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H18S/c1-9(2)7-10(3)5-4-8(9)6-11-10/h8H,4-7H2,1-3H3
