193-40-8 Usage
Description
9,14-Diazadibenzo[a,e]acephenanthrylene is a polycyclic aromatic hydrocarbon (PAH) compound characterized by a unique molecular structure that features two nitrogen atoms and multiple aromatic rings. As a heterocyclic compound, it is not typically found in nature but can be synthesized in a laboratory. Its complex structure and properties make it a subject of interest for researchers in organic chemistry and material science.
Uses
Used in Organic Chemistry Research:
9,14-Diazadibenzo[a,e]acephenanthrylene is used as a research compound for studying the behavior and properties of PAHs, particularly in the context of organic chemistry. Its unique structure allows for the exploration of chemical reactions and interactions that can lead to the development of novel organic materials.
Used in Material Science:
In the field of material science, 9,14-Diazadibenzo[a,e]acephenanthrylene is utilized as a building block for the synthesis of more complex chemical compounds. Its potential applications include the creation of advanced materials with specific properties, such as improved conductivity or stability.
Used in Environmental and Health Studies:
9,14-Diazadibenzo[a,e]acephenanthrylene is also used in studies aimed at understanding the impact of PAHs on human health and the environment. Its chemical properties and reactivity provide insights into how PAHs may behave in various settings, which can inform strategies for mitigating potential risks.
Check Digit Verification of cas no
The CAS Registry Mumber 193-40-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,9 and 3 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 193-40:
(5*1)+(4*9)+(3*3)+(2*4)+(1*0)=58
58 % 10 = 8
So 193-40-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H12N2/c1-2-8-14-13(7-1)21-20-19(15-9-3-5-11-17(15)23-21)16-10-4-6-12-18(16)24-22(14)20/h1-12H
193-40-8Relevant articles and documents
Cyclic Amidines Part 25. Intramolecular Cyclodehalogenation of Diazabenzanthracenes and Diazabenzophenanthrenes
Bloomfield, Derek G.,Upton, Christopher,Vipond, Hilton J.
, p. 857 - 860 (2007/10/02)
A previously unrecorded intramolecular cyclization which occurred during the palladium-catalysed hydrogenolysis of suitably disposed dichloroheterocycles anthracene (3) to 9,14-diazabenzaceanthrylene