1931-60-8 Usage
Uses
Used in Polymer and Plastics Industry:
Itaconyl chloride is used as a key ingredient for the production of polymers and plastics, contributing to the manufacturing of a wide range of products such as adhesives, paints, and coatings. Its reactivity allows for the formation of strong chemical bonds, enhancing the durability and performance of these materials.
Used in Acrylic Acid and Derivatives Production:
Itaconyl chloride plays a vital role in the synthesis of acrylic acid and its derivatives, which are extensively used in the production of various industrial and consumer products. Its presence in the manufacturing process ensures the formation of high-quality end products with desirable properties.
Used in Cross-Linking Agent Synthesis for Resins:
In the resin industry, itaconyl chloride is employed as a precursor for the synthesis of cross-linking agents. These agents are essential for improving the mechanical properties and chemical resistance of resins, making them suitable for various applications, such as coatings, adhesives, and composite materials.
Used in Specialty Chemicals Production:
Itaconyl chloride is also utilized in the production of specialty chemicals, which are tailored for specific applications in industries like pharmaceuticals, agriculture, and textiles. Its unique reactivity and properties enable the development of innovative and high-performance specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 1931-60-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,3 and 1 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1931-60:
(6*1)+(5*9)+(4*3)+(3*1)+(2*6)+(1*0)=78
78 % 10 = 8
So 1931-60-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H4Cl2O2/c1-3(5(7)9)2-4(6)8/h1-2H2
