193153-60-5 Usage
General Description
4-Pyridinemethanamine, N-cyclopropyl-(9CI) is a chemical compound with the molecular formula C8H10N2. It is also known as cyclopropylpyridin-4-amine and is classified as a pyridine derivative. 4-Pyridinemethanamine,N-cyclopropyl-(9CI) is characterized by a cyclopropyl group attached to a pyridine ring, which gives it unique structural and chemical properties. It is commonly used in organic synthesis and pharmaceutical research as a building block for the preparation of various compounds. Its cyclopropyl group makes it a valuable intermediate for the synthesis of biologically active molecules, making it a valuable chemical in medicinal chemistry and drug development. Additionally, it has potential applications in the development of agrochemicals and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 193153-60-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,3,1,5 and 3 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 193153-60:
(8*1)+(7*9)+(6*3)+(5*1)+(4*5)+(3*3)+(2*6)+(1*0)=135
135 % 10 = 5
So 193153-60-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2/c1-2-9(1)11-7-8-3-5-10-6-4-8/h3-6,9,11H,1-2,7H2
193153-60-5Relevant articles and documents
PYRIDAZINONE DERIVATIVES AND USE THEREOF AS P2X7 RECEPTOR INHIBITORS
-
Page/Page column 120, (2009/06/27)
Novel pyridazinone compounds of formula (I), which inhibit the purinergic P2X7 receptor and are useful for prevention, therapy and improvement of inflammatory and immunological diseases.
