19328-56-4 Usage
Uses
Used in Organic Synthesis:
Ammonium 3-nitrobenzoate is used as a reagent in organic synthesis for the production of various chemical compounds. Its versatile chemical properties make it a valuable component in the synthesis of dyes, pharmaceuticals, and other organic chemicals.
Used in Laboratory Research:
In laboratory settings, ammonium 3-nitrobenzoate is utilized as a catalyst or precursor for the synthesis of a range of chemical compounds. Its ability to facilitate reactions and initiate the formation of desired products makes it an essential tool in research and development.
Used in Industrial Applications:
Ammonium 3-nitrobenzoate is also employed in industrial applications as a reagent, catalyst, or precursor. Its role in the synthesis of various chemical compounds contributes to the production of dyes, pharmaceuticals, and other organic chemicals, making it a crucial component in the manufacturing process.
Safety Precautions:
Due to its explosive and flammable nature, ammonium 3-nitrobenzoate requires careful handling and storage. Proper safety measures should be taken to minimize the risk of accidents and ensure the safe use of ammonium 3-nitrobenzoate in both laboratory and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 19328-56-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,3,2 and 8 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 19328-56:
(7*1)+(6*9)+(5*3)+(4*2)+(3*8)+(2*5)+(1*6)=124
124 % 10 = 4
So 19328-56-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5NO4.H3N/c9-7(10)5-2-1-3-6(4-5)8(11)12;/h1-4H,(H,9,10);1H3
