19345-02-9 Usage
General Description
(2-Methyl-3-Phenyltetrahydro-5-Isoxazolyl)Methanol is a complex organic compound made up of several functional groups such as isoxazole ring, phenyl ring, and hydroxyl group. Isoxazole is a heterocyclic compound, a ring that consists of different elements, namely three carbon atoms, one oxygen atom, and one nitrogen atom. The phenyl group is a functional group made up of six carbon atoms arranged in a cyclic manner, referred to as a benzene ring. Methanol is a simple alcohol with one carbon atom. The inclusion of a Methyl group (a carbon atom bonded to three hydrogen atoms) along with these other structures suggests this compound likely exhibits unique chemical behavior and properties. It's potentially used in various branches of chemistry, including pharmaceutical, organic synthesis, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 19345-02-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,3,4 and 5 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 19345-02:
(7*1)+(6*9)+(5*3)+(4*4)+(3*5)+(2*0)+(1*2)=109
109 % 10 = 9
So 19345-02-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO2/c1-12-11(7-10(8-13)14-12)9-5-3-2-4-6-9/h2-6,10-11,13H,7-8H2,1H3/t10-,11+/m1/s1
