1939-68-0 Usage
Propiophenone derivative
It is derived from propiophenone, which is a chemical compound belonging to the class of phenols.
Two hydroxyl groups
The compound has two hydroxyl (-OH) groups attached to the carbon chain, which can form hydrogen bonds and participate in various chemical reactions.
Methyl group
A methyl (-CH3) group is attached to the carbon chain, which can influence the compound's chemical reactivity and physical properties.
Potential applications in pharmaceuticals
Due to its unique chemical structure, 2'-(2,3-Dihydroxypropoxy)-5'-methylpropiophenone may have potential uses in the development of new drugs or as an active ingredient in medications.
Building block for synthesis of other compounds
The compound can be used as a starting material or intermediate in the synthesis of other chemical compounds, allowing for the creation of a diverse range of molecules.
Use in research settings
The compound may be utilized in various research projects to study its unique properties, potential biological activities, and possible applications in different fields.
Unique properties and potential biological activities
The specific chemical structure of 2'-(2,3-Dihydroxypropoxy)-5'-methylpropiophenone may result in distinctive properties and biological activities that warrant further investigation and exploration.
Check Digit Verification of cas no
The CAS Registry Mumber 1939-68-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,3 and 9 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1939-68:
(6*1)+(5*9)+(4*3)+(3*9)+(2*6)+(1*8)=110
110 % 10 = 0
So 1939-68-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O4/c1-3-12(16)11-6-9(2)4-5-13(11)17-8-10(15)7-14/h4-6,10,14-15H,3,7-8H2,1-2H3
