19396-03-3 Usage
General Description
Polyoxin A is a chemical compound known for its antifungal properties. It is derived from a strain of the bacterium Streptomyces cacaoi and acts by inhibiting the synthesis of chitin, a key component in the cell walls of fungi, thus it effectively controls fungal growth. This chemical compound is commonly used in agricultural contexts as a natural pesticide, particularly for plants prone to fungal diseases. Despite its handling efficiency, Polyoxin A is considered safe for humans and the environment as it degrades quickly and does not accumulate in soil or water.
Check Digit Verification of cas no
The CAS Registry Mumber 19396-03-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,3,9 and 6 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 19396-03:
(7*1)+(6*9)+(5*3)+(4*9)+(3*6)+(2*0)+(1*3)=133
133 % 10 = 3
So 19396-03-3 is a valid CAS Registry Number.
InChI:InChI=1/C23H32N6O14/c1-2-7-3-28(12(7)21(38)39)19(37)11(26-18(36)10(24)13(32)9(31)6-42-22(25)40)16-14(33)15(34)20(43-16)29-4-8(5-30)17(35)27-23(29)41/h2,4,9-16,20,30-34H,3,5-6,24H2,1H3,(H2,25,40)(H,26,36)(H,38,39)(H,27,35,41)/b7-2-/t9-,10-,11-,12-,13+,14-,15+,16+,20+/m0/s1