19396-06-6 Usage
Description
Polyoxin B is a naturally occurring antibiotic compound derived from the bacterium Streptomyces cacaoi var. asoensis. It possesses potent fungicidal properties and is known for its ability to inhibit the growth of various fungal species, making it a valuable asset in the agricultural and pharmaceutical industries.
Uses
Used in Agricultural Industry:
Polyoxin B is used as a fungicide for the protection of crops, particularly against Alternaria leaf spot, a common fungal disease that affects a wide range of agricultural products. Its application helps in reducing crop losses and maintaining the quality of produce.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Polyoxin B is utilized as a fungicide in the development of pesticides and other antifungal treatments. Its effectiveness against various fungal pathogens makes it a crucial component in the formulation of products aimed at controlling fungal infections and diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 19396-06-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,3,9 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 19396-06:
(7*1)+(6*9)+(5*3)+(4*9)+(3*6)+(2*0)+(1*6)=136
136 % 10 = 6
So 19396-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H25N5O13/c18-6(8(25)5(24)3-34-16(19)32)13(29)20-7(15(30)31)11-9(26)10(27)14(35-11)22-1-4(2-23)12(28)21-17(22)33/h1,5-11,14,23-27H,2-3,18H2,(H2,19,32)(H,20,29)(H,30,31)(H,21,28,33)
19396-06-6Relevant articles and documents
First total syntheses of (+)-polyoxin B and (+)-Polyoxin D
Uchida, Kimio,Kato, Keisuke,Yamaguchi, Kentaro,Akita, Hiroyuki
, p. 2253 - 2259 (2007/10/03)
First total syntheses of the peptidyl nucleoside antibiotics, polyoxins B (1) and D (2), are achieved based on the coupling reactions of the N-protected L-carbamoyl-polyoxamic acid derivative (6) with polyoxin C (8), 6 with polyoxin C acid (9), respectively.