19416-70-7 Usage
General Description
Ammonium 4-nitrobenzoate dihydrate is a chemical compound that consists of ammonium ions, 4-nitrobenzoate ions, and two molecules of water. It is a crystalline solid with a yellow color and is soluble in water. Ammonium 4-nitrobenzoate dihydrate is commonly used in organic synthesis and as a reagent in chemical reactions. It is also used in the production of pharmaceuticals and is a common intermediate in the synthesis of various organic compounds. Additionally, it is used in research and development laboratories for various applications. The dihydrate form of the compound indicates that it contains two molecules of water in its crystal structure, which can impact its physical and chemical properties. Overall, Ammonium 4-nitrobenzoate dihydrate is a versatile chemical with various industrial and scientific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 19416-70-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,4,1 and 6 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 19416-70:
(7*1)+(6*9)+(5*4)+(4*1)+(3*6)+(2*7)+(1*0)=117
117 % 10 = 7
So 19416-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H5NO4.H3N/c9-7(10)5-1-3-6(4-2-5)8(11)12;/h1-4H,(H,9,10);1H3
