194491-03-7 Usage
General Description
2-Iodomethylbenzoic acid ethyl ester is a chemical compound with the formula C10H11IO2. It is derived from benzoic acid and ethyl ester, and is characterized by the presence of an iodomethyl group attached to the benzene ring. 2-IODOMETHYLBENZOIC ACID ETHYL ESTER is commonly used as a starting material in organic synthesis and serves as a precursor for the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. It is also utilized in the field of medicinal chemistry for the development of novel drug candidates. 2-Iodomethylbenzoic acid ethyl ester is considered to be a valuable building block in the synthesis of complex organic molecules due to its reactivity and functional group compatibility.
Check Digit Verification of cas no
The CAS Registry Mumber 194491-03-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,4,4,9 and 1 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 194491-03:
(8*1)+(7*9)+(6*4)+(5*4)+(4*9)+(3*1)+(2*0)+(1*3)=157
157 % 10 = 7
So 194491-03-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H11IO2/c1-2-13-10(12)9-6-4-3-5-8(9)7-11/h3-6H,2,7H2,1H3