194491-03-7 Usage
Uses
Used in Organic Synthesis:
2-Iodomethylbenzoic acid ethyl ester is used as a starting material in organic synthesis for the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. Its reactivity and functional group compatibility make it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Iodomethylbenzoic acid ethyl ester is used as a precursor for the development of novel drug candidates. Its unique structure and reactivity contribute to the discovery and synthesis of new compounds with potential therapeutic applications.
Used in Medicinal Chemistry:
2-Iodomethylbenzoic acid ethyl ester is utilized in the field of medicinal chemistry for the design and synthesis of new drug candidates. Its functional groups and reactivity enable the development of innovative molecules with improved pharmacological properties and therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 194491-03-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,4,4,9 and 1 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 194491-03:
(8*1)+(7*9)+(6*4)+(5*4)+(4*9)+(3*1)+(2*0)+(1*3)=157
157 % 10 = 7
So 194491-03-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H11IO2/c1-2-13-10(12)9-6-4-3-5-8(9)7-11/h3-6H,2,7H2,1H3
