195-52-8 Usage
General Description
Phenanthro[3,4-b]thiophene is a polycyclic aromatic compound that consists of a phenanthrene ring fused to a thiophene ring. It is commonly used as a building block in the synthesis of organic electronic materials, such as organic semiconductors and light-emitting diodes. Phenanthro[3,4-b]thiophene exhibits good thermal and chemical stability, making it suitable for various applications in the field of organic electronics. Its unique molecular structure and electronic properties make it a promising candidate for the development of high-performance organic electronic devices. Additionally, its potential use in the field of photochemistry and medicinal chemistry as a versatile building block further expands its significance in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 195-52-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,9 and 5 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 195-52:
(5*1)+(4*9)+(3*5)+(2*5)+(1*2)=68
68 % 10 = 8
So 195-52-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H10S/c1-2-4-13-11(3-1)5-6-12-7-8-15-14(16(12)13)9-10-17-15/h1-10H
195-52-8Relevant academic research and scientific papers
Synthesis of trans-dihydrodiol derivatives of phenanthro[3,4-b]-thiophene and phenanthro[4,3-b]thiophene
Kumar, Subodh,Saravanan, Srinivasan,Reuben, Peter,Kumar, Atul
, p. 1345 - 1355 (2007/10/03)
The present study describes the synthesis of phenanthro[3,4-b]thiophene (3), phenanthro[4,3-b]thiophene (4) and its potential dihydrodiol metabolites, trans-6,7-dihydroxy-6,7-dihydrophenanthro[3,4-b]thiophene (5) and trans-8,9-dihydroxy-8,9-dihydrophenant
