19519-55-2 Usage
Uses
Used in Pharmaceutical Industry:
1,3-Bis[(2R)-2-piperidinyl]-2-propanone is used as a pharmaceutical compound for its potential therapeutic properties. The compound's unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, 1,3-Bis[(2R)-2-piperidinyl]-2-propanone serves as a valuable compound for studying the properties and reactivity of piperidine alkaloids. Its unique structure can provide insights into the design and synthesis of new molecules with potential applications in various industries.
Used in Material Science:
1,3-Bis[(2R)-2-piperidinyl]-2-propanone can be utilized in material science as a component in the development of novel materials with specific properties. Its unique structure may contribute to the creation of materials with enhanced performance characteristics, such as improved stability or reactivity.
Used in Analytical Chemistry:
As an analytical chemistry standard, 1,3-Bis[(2R)-2-piperidinyl]-2-propanone can be employed for the calibration of instruments and the development of new analytical methods. Its distinct properties make it a useful reference compound for the accurate measurement and identification of similar molecules in complex samples.
Check Digit Verification of cas no
The CAS Registry Mumber 19519-55-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,5,1 and 9 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 19519-55:
(7*1)+(6*9)+(5*5)+(4*1)+(3*9)+(2*5)+(1*5)=132
132 % 10 = 2
So 19519-55-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3/t8-,9-,10+/m1/s1
