1952-67-6 Usage
Uses
Used in Pharmaceutical Industry:
5-(2-butenyl)-5-ethyl-1H,3H,5H-pyrimidine-2,4,6-trione is used as a potential pharmaceutical compound for its possible biological activity. It may be utilized in the development of new drugs due to its unique structure and potential interactions with biological targets.
Used in Agrochemical Industry:
In the agrochemical field, 5-(2-butenyl)-5-ethyl-1H,3H,5H-pyrimidine-2,4,6-trione is used as a potential active ingredient in pesticides or herbicides. Its specific properties may contribute to the control of pests or unwanted plant growth, enhancing crop protection strategies.
Used in Materials Science:
5-(2-butenyl)-5-ethyl-1H,3H,5H-pyrimidine-2,4,6-trione is used as a building block in materials science for the synthesis of new materials with unique properties. Its incorporation into polymers or other materials may lead to the development of advanced materials with applications in various industries, such as electronics, coatings, or textiles.
Note: The specific applications and reasons mentioned above are hypothetical and based on the general potential of pyrimidine derivatives. Further research is necessary to validate these uses and understand the compound's full potential.
Check Digit Verification of cas no
The CAS Registry Mumber 1952-67-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,5 and 2 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1952-67:
(6*1)+(5*9)+(4*5)+(3*2)+(2*6)+(1*7)=96
96 % 10 = 6
So 1952-67-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O3.Na/c1-3-5-6-10(4-2)7(13)11-9(15)12-8(10)14;/h3,5H,4,6H2,1-2H3,(H2,11,12,13,14,15);/q;+1/p-1/b5-3+;
