1953-33-9 Usage
General Description
5-butyl-1H,3H,5H-pyrimidine-2,4,6-trione is a chemical compound that belongs to the class of pyrimidine derivatives. It is a white to off-white crystalline solid with a faint odor. 5-butyl-1H,3H,5H-pyrimidine-2,4,6-trione is often used in the pharmaceutical industry for the synthesis of various drugs, particularly those targeting the central nervous system. It has also been studied for its potential use in the treatment of various neurological disorders and as an anticonvulsant. Additionally, 5-butyl-1H,3H,5H-pyrimidine-2,4,6-trione has been researched for its insecticidal properties and as a potential herbicide. However, its potential toxicity and environmental impact need to be further evaluated before widespread use.
Check Digit Verification of cas no
The CAS Registry Mumber 1953-33-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,5 and 3 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1953-33:
(6*1)+(5*9)+(4*5)+(3*3)+(2*3)+(1*3)=89
89 % 10 = 9
So 1953-33-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2O3/c1-2-3-4-5-6(11)9-8(13)10-7(5)12/h5H,2-4H2,1H3,(H2,9,10,11,12,13)
