1953-89-5 Usage
General Description
2,6-Dichloro-N-(hydroxymethyl)thiobenzamide is a chemical compound with the molecular formula C8H6Cl2NOS. It is a derivative of benzanilide and contains chlorine, nitrogen, oxygen, sulfur, and carbon atoms. 2,6-Dichloro-N-(hydroxymethyl)thiobenzamide is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its diverse biological activities, including antifungal and antiviral properties. Additionally, it has been studied for its potential in inhibiting cancer cell growth and DNA methyltransferase activity. Overall, 2,6-Dichloro-N-(hydroxymethyl)thiobenzamide is a versatile compound with potential applications in various fields, including medicine and agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 1953-89-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,5 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1953-89:
(6*1)+(5*9)+(4*5)+(3*3)+(2*8)+(1*9)=105
105 % 10 = 5
So 1953-89-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H7Cl2NOS/c9-5-2-1-3-6(10)7(5)8(13)11-4-12/h1-3,12H,4H2,(H,11,13)
