195441-31-7Relevant academic research and scientific papers
The synthesis of novel bridging cyclopentadienyl W-Sn(IV) bonded bimetallic complexes
Wang, Ji-Tao,He, Hai-Yang,Xu, Yu-Ming,Sun, Jie,Kong, Xiang-Fu
, p. 25 - 29 (1997)
The reaction of CH3COC5H4(CO)3MoSnCl3 with 2,4-dinitrophenyl-hydrazine yielded the corresponding hydrazone, Cl3SnMo(CO)3C5H4(CH3)C=N-NHC6H3(NO2)2 (1). Crystals of 1 are monoclinic; a = 8.6724(9), b = 21.549(2), c = 12.378(1) A, β= 102.099(8)°, space group, P21/n, Z = 4, Mo-Sn distance 2.7040(7) A. The reaction of CH3COC5H4(CO)3WSnCl3 with benzoyl-hydrazine in refluxing ethanol gave μ[C5H4(CH3)C=N-N=C(O)PH]W-SnCl2(C2H5OH)2 (2). Crystals of 2 are monoclinic, a = 16.897(2), b = 13.780(1), c = 12.429(2) A, β = 116.80(1)°, space group Cc, Z = 4, W-Sn distance 2.7767(9) A.
