1955-68-6 Usage
Uses
Used in Organic Synthesis:
L-ASPARTIC ACID BETA-HYDROXAMATE is used as an organic synthesis intermediate for the production of various chemical compounds. Its unique structure allows it to be a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
L-ASPARTIC ACID BETA-HYDROXAMATE is used as a pharmaceutical intermediate, playing a crucial role in the development and production of various drugs. Its properties make it suitable for use in the creation of new pharmaceutical compounds with potential therapeutic applications.
Used in Laboratory Research and Development:
L-ASPARTIC ACID BETA-HYDROXAMATE is utilized in laboratory research and development processes, where it can be tested and experimented with to explore its potential applications and properties. This helps researchers gain a better understanding of the compound and its possible uses in various fields.
Used in Chemical Production Process:
L-ASPARTIC ACID BETA-HYDROXAMATE is also used in the chemical production process, where it can be incorporated into the manufacturing of various chemical products. Its presence in the production process can contribute to the development of new and innovative chemical products with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1955-68-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,5 and 5 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1955-68:
(6*1)+(5*9)+(4*5)+(3*5)+(2*6)+(1*8)=106
106 % 10 = 6
So 1955-68-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H8N2O4/c5-2(4(8)9)1-3(7)6-10/h2,10H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1