195829-12-0Relevant academic research and scientific papers
Synthesis and reactions of novel dipalladium(II) complexes of the type [{Pd[PPh2CH=C(R)-N-N=C(R)CHPPh2]}2] (R = But or Ph). Crystal structure of the tert-butyl complex containing two Pd-C bonds and five fused chelate rings
Ike, Uchenna U.,Shaw, Bernard L.,Thornton-Pett, Mark
, p. 2613 - 2620 (1997)
Treatment of the neutral chloropalladium(III) complexes [PdCl{PPh2CH=C(R)-N-N=C(R)CH2PPh2}] (R = But 1a or Ph 1b) with two equivalents of Li[N(SiMe3)2] gave the novel dipalladium(II) complexes [{Pd[PPh2CH=C(R)-N-N=C(R)CHPPh2]}2] (R = But 2a or Ph 2b) containing two palladium-carbon bonds, five fused chelate rings and enamine type (C=C-N) moieties. Treatment of the chloroplatinum(II) complex [PtCl{PPh2CH=C(But)-N-N=C(But)CH 2PPh2}] 1c with an excess of KOBut in dimethyl sulfoxide (dmso) gave what was probably the species [Pt{PPh2CH=C(But)-N-N=C(But)CHPPh 2}(dmso)] 3 containing both a coordinated and an unco-ordinated phosphine. The dipalladium(II) complex 2a or 2b underwent electrophilic attack at the enamine carbon with acids (HX) to give salts of type [{Pd[PPh2CH2C(R)=N-N=C(R)CHPPh2]} 2]X2 4 (R = But or Ph; X = trifluoroacetate, chloride or picrate); these, when treated with sodium methoxide, deprotonated at the methylene carbon to give the neutral complex 2a or 2b. Treatment of 2a with less than 2 equivalents of trifluoroacetic acid gave the monoprotonated complex [Pd{PPh2CH=C(But)N-N=C(But)CHPPh 2}-{PPh2CH2C(But)=N-N=C(Bu t)CHPPh2}][O2CCF3]5a, mixed with 2a and 4a. Complex 2a with Br2 or MeI underwent attack at the enamine carbon C=C-N to give the corresponding bromo or methyl derivatives [{Pd[PPh2CH(R)CBut=N-N=C(But)CHPPh 2]}2]X2 (R = Br, X = Br 6a; R = Me, X = I 6b) respectively. When the methyl-substituted salt was treated with KOBut it gave the neutral dipalladium(II) complex [{PdCl[PPh2C(Me)= C(But)-N-N=C(But)CHPPh2]}2]7. The crystal structure of 2a was determined.
