196109-17-8 Usage
Description
TRIS(4-(VINYLOXY)BUTYL) TRIMELLITATE is a specialized organic compound that belongs to the class of carboxylic acids and derivatives. It is mostly used in industrial applications and can be potentially utilized as a key ingredient in the production of polymers, resins, or other chemical products. The exact properties such as solubility, toxicity, or reactivity of this compound highly depend on its specific form and usage. As with most chemicals, it should be handled with care following safety guidelines and its impact on health or environment should be assessed properly before use.
Uses
Used in Chemical Production Industry:
TRIS(4-(VINYLOXY)BUTYL) TRIMELLITATE is used as a key ingredient for the production of polymers, resins, or other chemical products. Its unique properties make it a valuable component in the synthesis of various industrial materials.
Used in Material Science:
TRIS(4-(VINYLOXY)BUTYL) TRIMELLITATE is used as a component in the development of new materials with specific properties, such as enhanced strength, flexibility, or chemical resistance. Its versatility in chemical reactions allows for the creation of materials tailored to various applications.
Used in Research and Development:
TRIS(4-(VINYLOXY)BUTYL) TRIMELLITATE is used as a research compound for studying its properties and potential applications in various fields. This can lead to the discovery of new uses and the development of innovative products in the chemical and materials science industries.
Check Digit Verification of cas no
The CAS Registry Mumber 196109-17-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,6,1,0 and 9 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 196109-17:
(8*1)+(7*9)+(6*6)+(5*1)+(4*0)+(3*9)+(2*1)+(1*7)=148
148 % 10 = 8
So 196109-17-8 is a valid CAS Registry Number.
InChI:InChI=1/C27H36O9/c1-4-31-15-7-10-18-34-25(28)22-13-14-23(26(29)35-19-11-8-16-32-5-2)24(21-22)27(30)36-20-12-9-17-33-6-3/h4-6,13-14,21H,1-3,7-12,15-20H2