19634-30-1 Usage
Uses
Used in Pharmaceutical Industry:
Methyl (8S)-8-methyl-6-oxo-7,8-dihydro-5H-2,7-naphthyridine-4-carboxyl ate is used as a pharmaceutical compound for its potential therapeutic applications. The compound's unique structure and properties make it a promising candidate for the development of new drugs and treatments.
Used in Chemical Research:
In the field of chemical research, methyl (8S)-8-methyl-6-oxo-7,8-dihydro-5H-2,7-naphthyridine-4-carboxyl ate serves as a valuable subject for studying the properties and reactivity of monoterpenoid alkaloids. This can lead to a better understanding of their potential applications in various industries, including pharmaceuticals, agriculture, and materials science.
Used in Natural Product Extraction:
Methyl (8S)-8-methyl-6-oxo-7,8-dihydro-5H-2,7-naphthyridine-4-carboxyl ate can be used in the extraction and purification of natural products from plant sources. Its presence in various plant species makes it a valuable target for the development of extraction methods and techniques, which can be applied to other similar compounds.
Used in Drug Delivery Systems:
Similar to gallotannin, methyl (8S)-8-methyl-6-oxo-7,8-dihydro-5H-2,7-naphthyridine-4-carboxyl ate can be employed in the development of novel drug delivery systems. These systems can enhance the compound's delivery, bioavailability, and therapeutic outcomes, making it more effective for various applications, including cancer treatment and other medical conditions.
References
Hart, Johns, Lamberton., Austral. f. Chem., 21, 1321 (1968)
Check Digit Verification of cas no
The CAS Registry Mumber 19634-30-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,6,3 and 4 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 19634-30:
(7*1)+(6*9)+(5*6)+(4*3)+(3*4)+(2*3)+(1*0)=121
121 % 10 = 1
So 19634-30-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O3/c1-6-8-4-12-5-9(11(15)16-2)7(8)3-10(14)13-6/h4-6H,3H2,1-2H3,(H,13,14)/t6-/m0/s1
