19713-89-4 Usage
Uses
Used in Chemical Synthesis:
3,4-Dimethyl-1H-pyrrole-2-carboxaldehyde is used as a key intermediate in the synthesis of various organic compounds and pharmaceuticals. Its unique structure and reactivity make it a valuable building block for the development of new molecules with potential applications in different industries.
Used in Flavor and Fragrance Industry:
3,4-Dimethyl-1H-pyrrole-2-carboxaldehyde is used as a flavoring agent for imparting specific aroma characteristics to food products, beverages, and confectionery items. Its unique scent profile contributes to the creation of complex and appealing flavor profiles in various consumer products.
Used in Pharmaceutical Industry:
3,4-Dimethyl-1H-pyrrole-2-carboxaldehyde is used as a starting material or intermediate in the synthesis of various pharmaceutical compounds, including drugs for the treatment of different diseases. Its versatile chemical properties allow for the development of new therapeutic agents with improved efficacy and safety profiles.
Used in Agrochemical Industry:
3,4-Dimethyl-1H-pyrrole-2-carboxaldehyde is used in the development of agrochemicals, such as pesticides and herbicides, to protect crops from pests and diseases. Its chemical properties enable the creation of effective and environmentally friendly solutions for agricultural applications.
Used in Dye and Pigment Industry:
3,4-Dimethyl-1H-pyrrole-2-carboxaldehyde is used as a precursor in the synthesis of dyes and pigments for various applications, including textiles, plastics, and printing inks. Its ability to form stable and vibrant colorants contributes to the development of high-quality products with improved performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 19713-89-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,1 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 19713-89:
(7*1)+(6*9)+(5*7)+(4*1)+(3*3)+(2*8)+(1*9)=134
134 % 10 = 4
So 19713-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO/c1-5-3-8-7(4-9)6(5)2/h3-4,8H,1-2H3
