19735-13-8 Usage
Uses
Used in Medicinal Chemistry and Pharmaceutical Research:
3-Methyl-3-phenylpiperidine is utilized as a precursor or intermediate in the synthesis of various drugs and pharmaceuticals, playing a crucial role in the development of new medications.
Used in the Development of Organic Compounds and Materials:
3-methyl-3-phenylpiperidine serves as a building block in the creation of novel organic compounds and materials, potentially leading to advancements in various industries that rely on chemical innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 19735-13-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,3 and 5 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 19735-13:
(7*1)+(6*9)+(5*7)+(4*3)+(3*5)+(2*1)+(1*3)=128
128 % 10 = 8
So 19735-13-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H17N/c1-12(8-5-9-13-10-12)11-6-3-2-4-7-11/h2-4,6-7,13H,5,8-10H2,1H3
