19735-13-8 Usage
General Description
3-Methyl-3-phenylpiperidine is a chemical compound with the molecular formula C13H19N. It is a tertiary amine that consists of a piperidine ring substituted at positions 3 with a methyl group and a phenyl group. 3-methyl-3-phenylpiperidine has potential applications in the field of medicinal chemistry and pharmaceutical research, as it can serve as a precursor or intermediate in the synthesis of various drugs and pharmaceuticals. Additionally, it may also have use in the development of new organic compounds and materials. However, due to its chemical structure and properties, 3-methyl-3-phenylpiperidine should be handled and used with the appropriate safety precautions and with consideration of its potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 19735-13-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,3 and 5 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 19735-13:
(7*1)+(6*9)+(5*7)+(4*3)+(3*5)+(2*1)+(1*3)=128
128 % 10 = 8
So 19735-13-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H17N/c1-12(8-5-9-13-10-12)11-6-3-2-4-7-11/h2-4,6-7,13H,5,8-10H2,1H3
