197364-68-4 Usage
Uses
Used in Medicinal Chemistry:
2-Benzothiazolemethanol,6-fluoro-(9CI) is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of new drug candidates with potential therapeutic applications.
Used in Drug Development:
In the pharmaceutical industry, 2-Benzothiazolemethanol,6-fluoro-(9CI) serves as a building block for designing and developing innovative drugs. Its incorporation into drug molecules can enhance their pharmacological properties, such as potency, selectivity, and bioavailability.
Used in Organic Chemistry Research:
2-Benzothiazolemethanol,6-fluoro-(9CI) is employed as a subject of study in organic chemistry to understand its chemical properties and reactivity. This research contributes to the advancement of synthetic methods and the discovery of new chemical reactions involving benzothiazole derivatives.
Used in Biological Activity Studies:
2-Benzothiazolemethanol,6-fluoro-(9CI) is also used in biological assays to evaluate its potential as a bioactive molecule. Research in this area aims to uncover its interactions with biological targets, such as enzymes, receptors, or cellular pathways, which could lead to the discovery of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 197364-68-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,7,3,6 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 197364-68:
(8*1)+(7*9)+(6*7)+(5*3)+(4*6)+(3*4)+(2*6)+(1*8)=184
184 % 10 = 4
So 197364-68-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H6FNOS/c9-5-1-2-6-7(3-5)12-8(4-11)10-6/h1-3,11H,4H2
