19780-66-6 Usage
Uses
Used in Chemical Production:
1-Pentene, 3-ethyl-2-methylis used as a precursor in the chemical industry for the production of various materials, including plastics, solvents, and synthetic rubber. Its carbon-carbon double bond allows it to participate in a range of chemical reactions, making it a valuable starting material for synthesizing other organic compounds.
Used in Polymerization Reactions:
In the polymer industry, 1-Pentene, 3-ethyl-2-methylis used as a monomer in polymerization processes. Its double bond enables the formation of long chains of molecules, contributing to the creation of polymers with specific properties for various applications.
Used in Oxidation Reactions:
1-Pentene, 3-ethyl-2-methylis also utilized in oxidation reactions, where it can be transformed into other chemical entities. These oxidation products may have different properties and uses, such as in the production of alcohols or ketones.
Used in Halogenation Processes:
In halogenation, 1-Pentene, 3-ethyl-2-methylreacts with halogens to form halogenated derivatives. These compounds can be used in various industrial applications, including the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in the Synthesis of Fragrances and Flavors:
Due to its reactive nature and distinctive odor, 1-Pentene, 3-ethyl-2-methylcan be employed in the synthesis of fragrances and flavors, where it may contribute to the creation of complex scent and taste profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 19780-66-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,8 and 0 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 19780-66:
(7*1)+(6*9)+(5*7)+(4*8)+(3*0)+(2*6)+(1*6)=146
146 % 10 = 6
So 19780-66-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H16/c1-5-8(6-2)7(3)4/h8H,3,5-6H2,1-2,4H3
