1980-54-7 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
4-HYDRAZINO-6-METHYL-2-(METHYLTHIO)PYRIMIDINE is utilized as a key component in the development of new pharmaceuticals due to its potential anti-cancer, anti-inflammatory, and antimicrobial properties. Its unique structure allows it to interact with various biological targets, making it a promising candidate for the treatment of different diseases.
Used in Organic Synthesis:
In the field of organic chemistry, 4-HYDRAZINO-6-METHYL-2-(METHYLTHIO)PYRIMIDINE serves as a valuable intermediate for the synthesis of other complex organic compounds and pharmaceuticals. Its versatile chemical properties enable it to be modified and incorporated into a wide range of molecules, contributing to the advancement of chemical research and the development of novel therapeutic agents.
Used in Anticancer Applications:
4-HYDRAZINO-6-METHYL-2-(METHYLTHIO)PYRIMIDINE is employed as an anticancer agent, where it may exhibit inhibitory effects on the growth and progression of various types of cancer. Its potential to target specific cellular pathways and mechanisms involved in cancer development makes it a valuable tool in the search for effective cancer treatments.
Used in Anti-inflammatory Applications:
As an anti-inflammatory agent, 4-HYDRAZINO-6-METHYL-2-(METHYLTHIO)PYRIMIDINE may help in reducing inflammation and associated symptoms in various conditions. Its potential to modulate inflammatory responses could contribute to the development of new therapies for inflammatory diseases.
Used in Antimicrobial Applications:
4-HYDRAZINO-6-METHYL-2-(METHYLTHIO)PYRIMIDINE also shows promise as an antimicrobial agent, potentially combating bacterial, fungal, or viral infections. Its ability to target and inhibit the growth of various microorganisms could lead to the development of new antimicrobial drugs to address the growing issue of antibiotic resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 1980-54-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,8 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1980-54:
(6*1)+(5*9)+(4*8)+(3*0)+(2*5)+(1*4)=97
97 % 10 = 7
So 1980-54-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N4S/c1-4-3-5(10-7)9-6(8-4)11-2/h3H,7H2,1-2H3,(H,8,9,10)
1980-54-7Relevant academic research and scientific papers
1-(Pyrimidin-4-yl)pyrazol-5(4H)-one derivatives: I. Synthesis of 3-methyl-1-(6-methyl-2-methylsulfanylpyrimidin-4-yl)-pyrazol-5-ol and specificity of its Knoevenagel reaction
Erkin,Krutikov
, p. 392 - 396 (2011/06/27)
3-Methyl-1-(6-methyl-2-methylsulfanylpyrimidin-4-yl)-1H-pyrazol-5-ol available via cyclocondensation of 6-methyl-2-methylsulfanylpyrimidin-4- ylhydrazine with ethyl acetoacetate reacted with aromatic aldehydes to give two kinds of products, 4-arylmethylid
