19817-88-0 Usage
General Description
N-HEXANOYL-D-GLUCOSAMINE is a chemical compound consisting of a hexanoyl group attached to the sugar molecule glucosamine. It is commonly used in the synthesis of glycolipids and lipopolysaccharides, which are essential components of bacterial cell membranes. N-HEXANOYL-D-GLUCOSAMINE has also been shown to have antibacterial and anti-inflammatory properties, making it a potential candidate for pharmaceutical and therapeutic applications. Additionally, this compound has been studied for its role in modulating immune responses and as a potential treatment for autoimmune diseases. Overall, N-HEXANOYL-D-GLUCOSAMINE plays a crucial role in the development of bacterial cell structures and has potential implications for medical and healthcare research.
Check Digit Verification of cas no
The CAS Registry Mumber 19817-88-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,8,1 and 7 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 19817-88:
(7*1)+(6*9)+(5*8)+(4*1)+(3*7)+(2*8)+(1*8)=150
150 % 10 = 0
So 19817-88-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H23NO6/c1-2-3-4-5-8(15)13-9-11(17)10(16)7(6-14)19-12(9)18/h7,9-12,14,16-18H,2-6H2,1H3,(H,13,15)/t7-,9-,10-,11-,12?/m1/s1
